C18H25N5O2 — CID 20885675
N-[2-(cyclohexen-1-yl)ethyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide (PubChem CID 20885675) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide |
|---|---|
| PubChem CID | 20885675 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide |
| SMILES | Cc1nn(CCCC(=O)NCCC2=CCCCC2)c(=O)c2nccn12 |
| InChI | InChI=1S/C18H25N5O2/c1-14-21-23(18(25)17-20-11-13-22(14)17)12-5-8-16(24)19-10-9-15-6-3-2-4-7-15/h6,11,13H,2-5,7-10,12H2,1H3,(H,19,24) |
| InChIKey | SHFSRZLGEVBNGX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|