About (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine
(5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine (PubChem CID 2088649) has the molecular formula C15H16ClN3S
and a molecular weight of 305.83 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine.
Molecular Properties
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine |
| PubChem CID | 2088649 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine |
| SMILES | [H]/N=C1\N=C(N2CCCCC2)S\C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3S/c16-12-6-4-11(5-7-12)10-13-14(17)18-15(20-13)19-8-2-1-3-9-19/h4-7,10,17H,1-3,8-9H2/b13-10+,17-14- |
| InChIKey | LQDVVLCGJAXCJD-JPVUGRAOSA-N |
| XLogP | 4.25 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine?
The IUPAC name of (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine (CID 2088649) is (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine.
What is the SMILES notation for (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine?
The canonical SMILES for (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine is [H]/N=C1\N=C(N2CCCCC2)S\C1=C\c1ccc(Cl)cc1.
What is the InChIKey of (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine?
The InChIKey is LQDVVLCGJAXCJD-JPVUGRAOSA-N. The full InChI is InChI=1S/C15H16ClN3S/c16-12-6-4-11(5-7-12)10-13-14(17)18-15(20-13)19-8-2-1-3-9-19/h4-7,10,17H,1-3,8-9H2/b13-10+,17-14-.
What are the key properties of (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine?
(5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine has a molecular weight of 305.83 g/mol, XLogP of 4.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(4-chlorophenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-imine is sourced from PubChem (CID 2088649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).