About 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid
2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid (PubChem CID 20886950) has the molecular formula C16H9ClN2O2S
and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
| PubChem CID | 20886950 |
| Molecular Formula | C16H9ClN2O2S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)sc1nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C16H9ClN2O2S/c17-11-4-1-9(2-5-11)12-8-19-13-6-3-10(15(20)21)7-14(13)22-16(19)18-12/h1-8H,(H,20,21) |
| InChIKey | HBTAJEUZKNAUEC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid?
The IUPAC name of 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid (CID 20886950) is 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid is O=C(O)c1ccc2c(c1)sc1nc(-c3ccc(Cl)cc3)cn12.
What is the InChIKey of 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid?
The InChIKey is HBTAJEUZKNAUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClN2O2S/c17-11-4-1-9(2-5-11)12-8-19-13-6-3-10(15(20)21)7-14(13)22-16(19)18-12/h1-8H,(H,20,21).
What are the key properties of 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid?
2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid has a molecular weight of 328.78 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid is sourced from PubChem (CID 20886950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).