About 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone
2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 20887437) has the molecular formula C14H18N4OS
and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone |
| PubChem CID | 20887437 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CSc2nc3ncccc3[nH]2)CC1 |
| InChI | InChI=1S/C14H18N4OS/c1-10-4-7-18(8-5-10)12(19)9-20-14-16-11-3-2-6-15-13(11)17-14/h2-3,6,10H,4-5,7-9H2,1H3,(H,15,16,17) |
| InChIKey | YVKDQWKYMHHMAD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone?
The IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone (CID 20887437) is 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone.
What is the SMILES notation for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone?
The canonical SMILES for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone is CC1CCN(C(=O)CSc2nc3ncccc3[nH]2)CC1.
What is the InChIKey of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone?
The InChIKey is YVKDQWKYMHHMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4OS/c1-10-4-7-18(8-5-10)12(19)9-20-14-16-11-3-2-6-15-13(11)17-14/h2-3,6,10H,4-5,7-9H2,1H3,(H,15,16,17).
What are the key properties of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone?
2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone has a molecular weight of 290.39 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-1-(4-methylpiperidin-1-yl)ethanone is sourced from PubChem (CID 20887437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).