About 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine
8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine (PubChem CID 20887746) has the molecular formula C12H9BrN2O
and a molecular weight of 277.12 g/mol. Its IUPAC name is 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine |
| PubChem CID | 20887746 |
| Molecular Formula | C12H9BrN2O |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine |
| SMILES | Brc1ccc2c(c1)CNc1cccnc1O2 |
| InChI | InChI=1S/C12H9BrN2O/c13-9-3-4-11-8(6-9)7-15-10-2-1-5-14-12(10)16-11/h1-6,15H,7H2 |
| InChIKey | ZDDWUOYBCBDOHM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine?
The IUPAC name of 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine (CID 20887746) is 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine.
What is the SMILES notation for 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine?
The canonical SMILES for 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine is Brc1ccc2c(c1)CNc1cccnc1O2.
What is the InChIKey of 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine?
The InChIKey is ZDDWUOYBCBDOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2O/c13-9-3-4-11-8(6-9)7-15-10-2-1-5-14-12(10)16-11/h1-6,15H,7H2.
What are the key properties of 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine?
8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine has a molecular weight of 277.12 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine is sourced from PubChem (CID 20887746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).