C13H12N2O2 — CID 20887751
10-methoxy-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine (PubChem CID 20887751) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 10-methoxy-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine.
| Compound Name | 10-methoxy-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 20887751 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 10-methoxy-5,6-dihydropyrido[2,3-b][1,4]benzoxazepine |
| SMILES | COc1cccc2c1Oc1ncccc1NC2 |
| InChI | InChI=1S/C13H12N2O2/c1-16-11-6-2-4-9-8-15-10-5-3-7-14-13(10)17-12(9)11/h2-7,15H,8H2,1H3 |
| InChIKey | ZCGWRGSKGWJBDQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |