C12H11Cl4N3O2 — CID 2088782
1-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperidine-4-carboxamide (PubChem CID 2088782) has the molecular formula C12H11Cl4N3O2 and a molecular weight of 371.05 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2088782 |
| Molecular Formula | C12H11Cl4N3O2 |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 1-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C12H11Cl4N3O2/c13-6-7(14)9(18-10(16)8(6)15)12(21)19-3-1-5(2-4-19)11(17)20/h5H,1-4H2,(H2,17,20) |
| InChIKey | VXLOOTYXSJOPDM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|