C15H18N2O5S — CID 20888370
1-acetyl-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 20888370) has the molecular formula C15H18N2O5S and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-acetyl-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-acetyl-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 20888370 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-acetyl-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)N3CCCC3)cc2CC1C(=O)O |
| InChI | InChI=1S/C15H18N2O5S/c1-10(18)17-13-5-4-12(8-11(13)9-14(17)15(19)20)23(21,22)16-6-2-3-7-16/h4-5,8,14H,2-3,6-7,9H2,1H3,(H,19,20) |
| InChIKey | AYIQZEQRNUGFGR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |