C14H14N2O — CID 20888478
1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonitrile (PubChem CID 20888478) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonitrile.
| Compound Name | 1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 20888478 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonitrile |
| SMILES | COc1cccc(-n2c(C)cc(C#N)c2C)c1 |
| InChI | InChI=1S/C14H14N2O/c1-10-7-12(9-15)11(2)16(10)13-5-4-6-14(8-13)17-3/h4-8H,1-3H3 |
| InChIKey | UADCVXBLJZGWOP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|