About N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide
N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide (PubChem CID 20889991) has the molecular formula C15H12FN3O2S
and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
| PubChem CID | 20889991 |
| Molecular Formula | C15H12FN3O2S |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ncccc21)Nc1ccccc1F |
| InChI | InChI=1S/C15H12FN3O2S/c16-10-4-1-2-5-11(10)18-13(20)8-19-12-6-3-7-17-15(12)22-9-14(19)21/h1-7H,8-9H2,(H,18,20) |
| InChIKey | PIIIUJWNPVJTKK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The IUPAC name of N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide (CID 20889991) is N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide.
What is the SMILES notation for N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The canonical SMILES for N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide is O=C(CN1C(=O)CSc2ncccc21)Nc1ccccc1F.
What is the InChIKey of N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The InChIKey is PIIIUJWNPVJTKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O2S/c16-10-4-1-2-5-11(10)18-13(20)8-19-12-6-3-7-17-15(12)22-9-14(19)21/h1-7H,8-9H2,(H,18,20).
What are the key properties of N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide has a molecular weight of 317.35 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide is sourced from PubChem (CID 20889991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).