C23H22FN5OS — CID 20890789
N-[4-(dimethylamino)phenyl]-2-[2-[(2-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]acetamide (PubChem CID 20890789) has the molecular formula C23H22FN5OS and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[2-[(2-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[2-[(2-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 20890789 |
| Molecular Formula | C23H22FN5OS |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[2-[(2-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)Cn2c(SCc3ccccc3F)nc3ccncc32)cc1 |
| InChI | InChI=1S/C23H22FN5OS/c1-28(2)18-9-7-17(8-10-18)26-22(30)14-29-21-13-25-12-11-20(21)27-23(29)31-15-16-5-3-4-6-19(16)24/h3-13H,14-15H2,1-2H3,(H,26,30) |
| InChIKey | SAIYSQJKTWRYPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|