C18H21N3O3 — CID 20892303
ethyl 3-[[2-(4,5,6,7-tetrahydroindazol-2-yl)acetyl]amino]benzoate (PubChem CID 20892303) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 3-[[2-(4,5,6,7-tetrahydroindazol-2-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-(4,5,6,7-tetrahydroindazol-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 20892303 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 3-[[2-(4,5,6,7-tetrahydroindazol-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)Cn2cc3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-2-24-18(23)13-7-5-8-15(10-13)19-17(22)12-21-11-14-6-3-4-9-16(14)20-21/h5,7-8,10-11H,2-4,6,9,12H2,1H3,(H,19,22) |
| InChIKey | CBZPKJSGKMAZTM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |