C16H11FN4OS — CID 20894788
5-(4-fluorophenyl)-11,13-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 20894788) has the molecular formula C16H11FN4OS and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-11,13-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-(4-fluorophenyl)-11,13-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 20894788 |
| Molecular Formula | C16H11FN4OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-(4-fluorophenyl)-11,13-dimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(-c3ccc(F)cc3)nnc12 |
| InChI | InChI=1S/C16H11FN4OS/c1-8-7-9(2)18-15-12(8)13-14(23-15)16(22)21(20-19-13)11-5-3-10(17)4-6-11/h3-7H,1-2H3 |
| InChIKey | LSRHTQIXABBJLV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |