C11H10N4OS — CID 20894795
5,11,13-trimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 20894795) has the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. Its IUPAC name is 5,11,13-trimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5,11,13-trimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 20894795 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5,11,13-trimethyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(C)nnc12 |
| InChI | InChI=1S/C11H10N4OS/c1-5-4-6(2)12-10-7(5)8-9(17-10)11(16)15(3)14-13-8/h4H,1-3H3 |
| InChIKey | MFDVFIMCHSUVOW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |