C15H9FN4OS — CID 20894826
5-(2-fluorophenyl)-11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 20894826) has the molecular formula C15H9FN4OS and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-(2-fluorophenyl)-11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 20894826 |
| Molecular Formula | C15H9FN4OS |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-(2-fluorophenyl)-11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1ccc2c(n1)sc1c(=O)n(-c3ccccc3F)nnc12 |
| InChI | InChI=1S/C15H9FN4OS/c1-8-6-7-9-12-13(22-14(9)17-8)15(21)20(19-18-12)11-5-3-2-4-10(11)16/h2-7H,1H3 |
| InChIKey | ACSGXZLKAWXDSN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |