C22H20N4O3S — CID 20895048
N-(3-acetylphenyl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 20895048) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 20895048 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 |
| InChI | InChI=1S/C22H20N4O3S/c1-12-13(2)23-19-8-7-16(10-18(12)19)21-25-26-22(29-21)30-11-20(28)24-17-6-4-5-15(9-17)14(3)27/h4-10,23H,11H2,1-3H3,(H,24,28) |
| InChIKey | OJXCXDWPNMMJDZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|