C15H10N2O3S — CID 2089520
4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzonitrile (PubChem CID 2089520) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzonitrile.
| Compound Name | 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 2089520 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C15H10N2O3S/c16-9-11-5-7-12(8-6-11)10-17-15(18)13-3-1-2-4-14(13)21(17,19)20/h1-8H,10H2 |
| InChIKey | FRTANVFUKLZIOQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |