C18H14ClN3O4S — CID 20896275
(2-chlorophenyl) 2-[[5-(benzamidomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 20896275) has the molecular formula C18H14ClN3O4S and a molecular weight of 403.85 g/mol. Its IUPAC name is (2-chlorophenyl) 2-[[5-(benzamidomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (2-chlorophenyl) 2-[[5-(benzamidomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 20896275 |
| Molecular Formula | C18H14ClN3O4S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (2-chlorophenyl) 2-[[5-(benzamidomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(CNC(=O)c2ccccc2)o1)Oc1ccccc1Cl |
| InChI | InChI=1S/C18H14ClN3O4S/c19-13-8-4-5-9-14(13)25-16(23)11-27-18-22-21-15(26-18)10-20-17(24)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,20,24) |
| InChIKey | WDSRJMUUVPHXCN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|