C22H22N2O4 — CID 2089693
[2-oxo-2-(propylamino)ethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 2089693) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2089693 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | CCCNC(=O)COC(=O)c1cc(-c2ccc(OC)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H22N2O4/c1-3-12-23-21(25)14-28-22(26)18-13-20(15-8-10-16(27-2)11-9-15)24-19-7-5-4-6-17(18)19/h4-11,13H,3,12,14H2,1-2H3,(H,23,25) |
| InChIKey | UIQAMHFWRDTMFZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |