C16H19NO4S3 — CID 20897675
(3S,4R)-1,1-dioxo-N-(1-phenylethyl)-4-thiophen-2-ylsulfonylthiolan-3-amine (PubChem CID 20897675) has the molecular formula C16H19NO4S3 and a molecular weight of 385.53 g/mol. Its IUPAC name is (3S,4R)-1,1-dioxo-N-(1-phenylethyl)-4-thiophen-2-ylsulfonylthiolan-3-amine.
| Compound Name | (3S,4R)-1,1-dioxo-N-(1-phenylethyl)-4-thiophen-2-ylsulfonylthiolan-3-amine |
|---|---|
| PubChem CID | 20897675 |
| Molecular Formula | C16H19NO4S3 |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (3S,4R)-1,1-dioxo-N-(1-phenylethyl)-4-thiophen-2-ylsulfonylthiolan-3-amine |
| SMILES | CC(N[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4S3/c1-12(13-6-3-2-4-7-13)17-14-10-23(18,19)11-15(14)24(20,21)16-8-5-9-22-16/h2-9,12,14-15,17H,10-11H2,1H3/t12?,14-,15-/m0/s1 |
| InChIKey | PGTJNPLCXXAJNY-ZRNAQANOSA-N |
| XLogP | 2.04 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |