About (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide
(3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 20897766) has the molecular formula C20H23FN2O4S2
and a molecular weight of 438.55 g/mol. Its IUPAC name is (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide |
| PubChem CID | 20897766 |
| Molecular Formula | C20H23FN2O4S2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@H](N2CCN(c3ccc(F)cc3)CC2)[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H23FN2O4S2/c21-16-6-8-17(9-7-16)22-10-12-23(13-11-22)19-14-28(24,25)15-20(19)29(26,27)18-4-2-1-3-5-18/h1-9,19-20H,10-15H2/t19-,20-/m0/s1 |
| InChIKey | SDSNYLXTHJSGKV-PMACEKPBSA-N |
| XLogP | 1.59 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide?
The IUPAC name of (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide (CID 20897766) is (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide.
What is the SMILES notation for (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide?
The canonical SMILES for (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide is O=S1(=O)C[C@H](N2CCN(c3ccc(F)cc3)CC2)[C@@H](S(=O)(=O)c2ccccc2)C1.
What is the InChIKey of (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide?
The InChIKey is SDSNYLXTHJSGKV-PMACEKPBSA-N. The full InChI is InChI=1S/C20H23FN2O4S2/c21-16-6-8-17(9-7-16)22-10-12-23(13-11-22)19-14-28(24,25)15-20(19)29(26,27)18-4-2-1-3-5-18/h1-9,19-20H,10-15H2/t19-,20-/m0/s1.
What are the key properties of (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide?
(3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide has a molecular weight of 438.55 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-(benzenesulfonyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 20897766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).