About (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine
(3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine (PubChem CID 20897865) has the molecular formula C13H18FNO5S2
and a molecular weight of 351.42 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 20897865 |
| Molecular Formula | C13H18FNO5S2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
| SMILES | COCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO5S2/c1-20-7-6-15-12-8-21(16,17)9-13(12)22(18,19)11-4-2-10(14)3-5-11/h2-5,12-13,15H,6-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | XTNUPHRYOMKIII-STQMWFEESA-N |
| XLogP | 0.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine (CID 20897865) is (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine is COCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine?
The InChIKey is XTNUPHRYOMKIII-STQMWFEESA-N. The full InChI is InChI=1S/C13H18FNO5S2/c1-20-7-6-15-12-8-21(16,17)9-13(12)22(18,19)11-4-2-10(14)3-5-11/h2-5,12-13,15H,6-9H2,1H3/t12-,13-/m0/s1.
What are the key properties of (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine?
(3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine has a molecular weight of 351.42 g/mol, XLogP of 0.00, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 20897865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).