C18H20FNO4S2 — CID 20897875
(3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-(1-phenylethyl)thiolan-3-amine (PubChem CID 20897875) has the molecular formula C18H20FNO4S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-(1-phenylethyl)thiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-(1-phenylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 20897875 |
| Molecular Formula | C18H20FNO4S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-(1-phenylethyl)thiolan-3-amine |
| SMILES | CC(N[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20FNO4S2/c1-13(14-5-3-2-4-6-14)20-17-11-25(21,22)12-18(17)26(23,24)16-9-7-15(19)8-10-16/h2-10,13,17-18,20H,11-12H2,1H3/t13?,17-,18-/m0/s1 |
| InChIKey | YRPOJJVXMWOENX-RHGDZWTLSA-N |
| XLogP | 2.12 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |