About (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine
(3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 20897924) has the molecular formula C14H21NO6S2
and a molecular weight of 363.46 g/mol. Its IUPAC name is (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 20897924 |
| Molecular Formula | C14H21NO6S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | COCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21NO6S2/c1-20-8-7-15-13-9-22(16,17)10-14(13)23(18,19)12-5-3-11(21-2)4-6-12/h3-6,13-15H,7-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | SSPOAVAACHJERZ-KBPBESRZSA-N |
| XLogP | -0.13 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine (CID 20897924) is (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine is COCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(OC)cc1.
What is the InChIKey of (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine?
The InChIKey is SSPOAVAACHJERZ-KBPBESRZSA-N. The full InChI is InChI=1S/C14H21NO6S2/c1-20-8-7-15-13-9-22(16,17)10-14(13)23(18,19)12-5-3-11(21-2)4-6-12/h3-6,13-15H,7-10H2,1-2H3/t13-,14-/m0/s1.
What are the key properties of (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine?
(3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine has a molecular weight of 363.46 g/mol, XLogP of -0.13, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-N-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 20897924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).