C14H20FNO5S2 — CID 20897970
(3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine (PubChem CID 20897970) has the molecular formula C14H20FNO5S2 and a molecular weight of 365.45 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 20897970 |
| Molecular Formula | C14H20FNO5S2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
| SMILES | COCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C14H20FNO5S2/c1-10-7-11(3-4-12(10)15)23(19,20)14-9-22(17,18)8-13(14)16-5-6-21-2/h3-4,7,13-14,16H,5-6,8-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | BMWXVMYKZCZTHR-KBPBESRZSA-N |
| XLogP | 0.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|