C15H20ClNO4S2 — CID 20898028
(3S,4R)-4-(4-chlorophenyl)sulfonyl-N-cyclopentyl-1,1-dioxothiolan-3-amine (PubChem CID 20898028) has the molecular formula C15H20ClNO4S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)sulfonyl-N-cyclopentyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-N-cyclopentyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 20898028 |
| Molecular Formula | C15H20ClNO4S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-N-cyclopentyl-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)C[C@H](NC2CCCC2)[C@@H](S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H20ClNO4S2/c16-11-5-7-13(8-6-11)23(20,21)15-10-22(18,19)9-14(15)17-12-3-1-2-4-12/h5-8,12,14-15,17H,1-4,9-10H2/t14-,15-/m0/s1 |
| InChIKey | HSWMOCKQWPGGMN-GJZGRUSLSA-N |
| XLogP | 1.81 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |