C19H22ClNO4S2 — CID 20898074
(3S,4R)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-phenylpropyl)thiolan-3-amine (PubChem CID 20898074) has the molecular formula C19H22ClNO4S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-phenylpropyl)thiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-phenylpropyl)thiolan-3-amine |
|---|---|
| PubChem CID | 20898074 |
| Molecular Formula | C19H22ClNO4S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-phenylpropyl)thiolan-3-amine |
| SMILES | O=S1(=O)C[C@H](NCCCc2ccccc2)[C@@H](S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H22ClNO4S2/c20-16-8-10-17(11-9-16)27(24,25)19-14-26(22,23)13-18(19)21-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,18-19,21H,4,7,12-14H2/t18-,19-/m0/s1 |
| InChIKey | RDTVNQSVBBQWFT-OALUTQOASA-N |
| XLogP | 2.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|