C15H17NO2S2 — CID 2089878
2,4-dimethyl-N-(3-methylsulfanylphenyl)benzenesulfonamide (PubChem CID 2089878) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2,4-dimethyl-N-(3-methylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-(3-methylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2089878 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2,4-dimethyl-N-(3-methylsulfanylphenyl)benzenesulfonamide |
| SMILES | CSc1cccc(NS(=O)(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C15H17NO2S2/c1-11-7-8-15(12(2)9-11)20(17,18)16-13-5-4-6-14(10-13)19-3/h4-10,16H,1-3H3 |
| InChIKey | LJDCOVRRFHAPGK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |