C28H23N3O3 — CID 20898844
12,14-dimethyl-17-(4-methylphenyl)-9-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 20898844) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 12,14-dimethyl-17-(4-methylphenyl)-9-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | 12,14-dimethyl-17-(4-methylphenyl)-9-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 20898844 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 12,14-dimethyl-17-(4-methylphenyl)-9-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3n2-c2ccccc2OC3c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-17-13-15-18(16-14-17)23-22-24(29(2)28(33)30(3)27(22)32)25-26(19-9-5-4-6-10-19)34-21-12-8-7-11-20(21)31(23)25/h4-16,26H,1-3H3 |
| InChIKey | OTUQWCJSLSJFGB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |