C25H20ClN3O2S — CID 20900164
[7-benzylsulfanyl-5-(4-chlorophenyl)-14-methyl-2-oxa-4,6,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-11-yl]methanol (PubChem CID 20900164) has the molecular formula C25H20ClN3O2S and a molecular weight of 461.97 g/mol. Its IUPAC name is [7-benzylsulfanyl-5-(4-chlorophenyl)-14-methyl-2-oxa-4,6,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-11-yl]methanol.
| Compound Name | [7-benzylsulfanyl-5-(4-chlorophenyl)-14-methyl-2-oxa-4,6,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-11-yl]methanol |
|---|---|
| PubChem CID | 20900164 |
| Molecular Formula | C25H20ClN3O2S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [7-benzylsulfanyl-5-(4-chlorophenyl)-14-methyl-2-oxa-4,6,13-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-11-yl]methanol |
| SMILES | Cc1ncc(CO)c2c1Oc1nc(-c3ccc(Cl)cc3)nc(SCc3ccccc3)c1C2 |
| InChI | InChI=1S/C25H20ClN3O2S/c1-15-22-20(18(13-30)12-27-15)11-21-24(31-22)28-23(17-7-9-19(26)10-8-17)29-25(21)32-14-16-5-3-2-4-6-16/h2-10,12,30H,11,13-14H2,1H3 |
| InChIKey | JITZABVZWNGKGC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |