C20H17N5O3S2 — CID 20901136
10-(3,4-dimethylphenyl)sulfonyl-N-(furan-2-ylmethyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine (PubChem CID 20901136) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 10-(3,4-dimethylphenyl)sulfonyl-N-(furan-2-ylmethyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine.
| Compound Name | 10-(3,4-dimethylphenyl)sulfonyl-N-(furan-2-ylmethyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
|---|---|
| PubChem CID | 20901136 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 10-(3,4-dimethylphenyl)sulfonyl-N-(furan-2-ylmethyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nnn3c2nc(NCc2ccco2)c2sccc23)cc1C |
| InChI | InChI=1S/C20H17N5O3S2/c1-12-5-6-15(10-13(12)2)30(26,27)20-19-22-18(21-11-14-4-3-8-28-14)17-16(7-9-29-17)25(19)24-23-20/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | LUKGCMROAFXMJN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |