C19H21N5O3S2 — CID 20901203
10-(4-ethylphenyl)sulfonyl-N-(3-methoxypropyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine (PubChem CID 20901203) has the molecular formula C19H21N5O3S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 10-(4-ethylphenyl)sulfonyl-N-(3-methoxypropyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine.
| Compound Name | 10-(4-ethylphenyl)sulfonyl-N-(3-methoxypropyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
|---|---|
| PubChem CID | 20901203 |
| Molecular Formula | C19H21N5O3S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 10-(4-ethylphenyl)sulfonyl-N-(3-methoxypropyl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
| SMILES | CCc1ccc(S(=O)(=O)c2nnn3c2nc(NCCCOC)c2sccc23)cc1 |
| InChI | InChI=1S/C19H21N5O3S2/c1-3-13-5-7-14(8-6-13)29(25,26)19-18-21-17(20-10-4-11-27-2)16-15(9-12-28-16)24(18)23-22-19/h5-9,12H,3-4,10-11H2,1-2H3,(H,20,21) |
| InChIKey | RIOVEEIJMAIHQH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|