C22H18FN5O2S2 — CID 20901219
10-(2,5-dimethylphenyl)sulfonyl-N-[(4-fluorophenyl)methyl]-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine (PubChem CID 20901219) has the molecular formula C22H18FN5O2S2 and a molecular weight of 467.55 g/mol. Its IUPAC name is 10-(2,5-dimethylphenyl)sulfonyl-N-[(4-fluorophenyl)methyl]-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine.
| Compound Name | 10-(2,5-dimethylphenyl)sulfonyl-N-[(4-fluorophenyl)methyl]-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
|---|---|
| PubChem CID | 20901219 |
| Molecular Formula | C22H18FN5O2S2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 10-(2,5-dimethylphenyl)sulfonyl-N-[(4-fluorophenyl)methyl]-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-amine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)c2nnn3c2nc(NCc2ccc(F)cc2)c2sccc23)c1 |
| InChI | InChI=1S/C22H18FN5O2S2/c1-13-3-4-14(2)18(11-13)32(29,30)22-21-25-20(24-12-15-5-7-16(23)8-6-15)19-17(9-10-31-19)28(21)27-26-22/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | SWCQKHRBUMYDGT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |