C18H23N3O2 — CID 20901467
1-[2-(cyclohexen-1-yl)ethyl]-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea (PubChem CID 20901467) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 20901467 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea |
| SMILES | Cc1ccc2onc(CNC(=O)NCCC3=CCCCC3)c2c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-7-8-17-15(11-13)16(21-23-17)12-20-18(22)19-10-9-14-5-3-2-4-6-14/h5,7-8,11H,2-4,6,9-10,12H2,1H3,(H2,19,20,22) |
| InChIKey | CXMUBHQVWDQLQX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|