C19H28N2O4S — CID 20901692
1-(cyclopropanecarbonyl)-2-methyl-N-(3-propan-2-yloxypropyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 20901692) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-2-methyl-N-(3-propan-2-yloxypropyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(cyclopropanecarbonyl)-2-methyl-N-(3-propan-2-yloxypropyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20901692 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-2-methyl-N-(3-propan-2-yloxypropyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(C)OCCCNS(=O)(=O)c1ccc2c(c1)CC(C)N2C(=O)C1CC1 |
| InChI | InChI=1S/C19H28N2O4S/c1-13(2)25-10-4-9-20-26(23,24)17-7-8-18-16(12-17)11-14(3)21(18)19(22)15-5-6-15/h7-8,12-15,20H,4-6,9-11H2,1-3H3 |
| InChIKey | DBBGYTNOKNWWDN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|