C25H27N3O5S — CID 20901709
4-[[1-(cyclopropanecarbonyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione (PubChem CID 20901709) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[[1-(cyclopropanecarbonyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione.
| Compound Name | 4-[[1-(cyclopropanecarbonyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 20901709 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 4-[[1-(cyclopropanecarbonyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione |
| SMILES | CC1Cc2cc(S(=O)(=O)N3CC(=O)N(CCc4ccccc4)C(=O)C3)ccc2N1C(=O)C1CC1 |
| InChI | InChI=1S/C25H27N3O5S/c1-17-13-20-14-21(9-10-22(20)28(17)25(31)19-7-8-19)34(32,33)26-15-23(29)27(24(30)16-26)12-11-18-5-3-2-4-6-18/h2-6,9-10,14,17,19H,7-8,11-13,15-16H2,1H3 |
| InChIKey | LNXONNKFBRBTEK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|