C17H26N6O2 — CID 20903711
N-(2-methoxyethyl)-3-[6-(4-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide (PubChem CID 20903711) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[6-(4-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[6-(4-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide |
|---|---|
| PubChem CID | 20903711 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-(2-methoxyethyl)-3-[6-(4-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide |
| SMILES | COCCNC(=O)CCc1nnc2ccc(N3CCC(C)CC3)nn12 |
| InChI | InChI=1S/C17H26N6O2/c1-13-7-10-22(11-8-13)16-4-3-14-19-20-15(23(14)21-16)5-6-17(24)18-9-12-25-2/h3-4,13H,5-12H2,1-2H3,(H,18,24) |
| InChIKey | RVSSFFUCBAQLOK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|