About 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one
6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one (PubChem CID 20904161) has the molecular formula C17H9ClN2O3
and a molecular weight of 324.72 g/mol. Its IUPAC name is 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one |
| PubChem CID | 20904161 |
| Molecular Formula | C17H9ClN2O3 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one |
| SMILES | O=c1oc2ccc(Cl)cc2cc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H9ClN2O3/c18-12-6-7-14-11(8-12)9-13(17(21)22-14)16-19-15(20-23-16)10-4-2-1-3-5-10/h1-9H |
| InChIKey | PCYIGIDTXCFPQZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one?
The IUPAC name of 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one (CID 20904161) is 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one.
What is the SMILES notation for 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one?
The canonical SMILES for 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one is O=c1oc2ccc(Cl)cc2cc1-c1nc(-c2ccccc2)no1.
What is the InChIKey of 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one?
The InChIKey is PCYIGIDTXCFPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClN2O3/c18-12-6-7-14-11(8-12)9-13(17(21)22-14)16-19-15(20-23-16)10-4-2-1-3-5-10/h1-9H.
What are the key properties of 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one?
6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one has a molecular weight of 324.72 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(3-phenyl-1,2,4-oxadiazol-5-yl)chromen-2-one is sourced from PubChem (CID 20904161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).