C17H17N5O3S — CID 20904542
N-(furan-2-ylmethyl)-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide (PubChem CID 20904542) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
|---|---|
| PubChem CID | 20904542 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
| SMILES | Cn1c(=O)c2sccc2n2c(CCCC(=O)NCc3ccco3)nnc12 |
| InChI | InChI=1S/C17H17N5O3S/c1-21-16(24)15-12(7-9-26-15)22-13(19-20-17(21)22)5-2-6-14(23)18-10-11-4-3-8-25-11/h3-4,7-9H,2,5-6,10H2,1H3,(H,18,23) |
| InChIKey | PKBOELPZASSSKM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |