C18H18N6O2S — CID 20904552
4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 20904552) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 20904552 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | Cn1c(=O)c2sccc2n2c(CCCC(=O)NCc3cccnc3)nnc12 |
| InChI | InChI=1S/C18H18N6O2S/c1-23-17(26)16-13(7-9-27-16)24-14(21-22-18(23)24)5-2-6-15(25)20-11-12-4-3-8-19-10-12/h3-4,7-10H,2,5-6,11H2,1H3,(H,20,25) |
| InChIKey | HXLITZYGUPYVKG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |