C26H32N6O2S — CID 20904710
N-(1-benzylpiperidin-4-yl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide (PubChem CID 20904710) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
|---|---|
| PubChem CID | 20904710 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
| SMILES | CCCn1c(=O)c2sccc2n2c(CCCC(=O)NC3CCN(Cc4ccccc4)CC3)nnc12 |
| InChI | InChI=1S/C26H32N6O2S/c1-2-14-31-25(34)24-21(13-17-35-24)32-22(28-29-26(31)32)9-6-10-23(33)27-20-11-15-30(16-12-20)18-19-7-4-3-5-8-19/h3-5,7-8,13,17,20H,2,6,9-12,14-16,18H2,1H3,(H,27,33) |
| InChIKey | URAKVVRTAHFOJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |