C18H24N2O2 — CID 20905674
2-(3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-3H-isoindol-1-one (PubChem CID 20905674) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-3H-isoindol-1-one.
| Compound Name | 2-(3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 20905674 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-3H-isoindol-1-one |
| SMILES | CC(C)C(C(=O)N1CCCCC1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O2/c1-13(2)16(18(22)19-10-6-3-7-11-19)20-12-14-8-4-5-9-15(14)17(20)21/h4-5,8-9,13,16H,3,6-7,10-12H2,1-2H3 |
| InChIKey | JLBQBZJKSKKISR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |