C18H20N2OS — CID 20907252
N-benzyl-2-ethyl-2,3-dihydro-1,4-benzothiazine-4-carboxamide (PubChem CID 20907252) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is N-benzyl-2-ethyl-2,3-dihydro-1,4-benzothiazine-4-carboxamide.
| Compound Name | N-benzyl-2-ethyl-2,3-dihydro-1,4-benzothiazine-4-carboxamide |
|---|---|
| PubChem CID | 20907252 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-benzyl-2-ethyl-2,3-dihydro-1,4-benzothiazine-4-carboxamide |
| SMILES | CCC1CN(C(=O)NCc2ccccc2)c2ccccc2S1 |
| InChI | InChI=1S/C18H20N2OS/c1-2-15-13-20(16-10-6-7-11-17(16)22-15)18(21)19-12-14-8-4-3-5-9-14/h3-11,15H,2,12-13H2,1H3,(H,19,21) |
| InChIKey | CCENZLGVWDCJOU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |