C29H37N3O2 — CID 20907880
2-[2-(cyclohexen-1-yl)ethyl]-N-cyclohexyl-3-methyl-1-oxo-6-phenyl-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 20907880) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-N-cyclohexyl-3-methyl-1-oxo-6-phenyl-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-N-cyclohexyl-3-methyl-1-oxo-6-phenyl-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 20907880 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-N-cyclohexyl-3-methyl-1-oxo-6-phenyl-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)Cn2c(ccc2-c2ccccc2)C(=O)N1CCC1=CCCCC1 |
| InChI | InChI=1S/C29H37N3O2/c1-29(28(34)30-24-15-9-4-10-16-24)21-31-25(23-13-7-3-8-14-23)17-18-26(31)27(33)32(29)20-19-22-11-5-2-6-12-22/h3,7-8,11,13-14,17-18,24H,2,4-6,9-10,12,15-16,19-21H2,1H3,(H,30,34) |
| InChIKey | VGHXNZVXZLKBLK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|