About naphthalen-1-ylmethanol
naphthalen-1-ylmethanol (PubChem CID 20908) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is naphthalen-1-ylmethanol.
Molecular Properties
| Compound Name | naphthalen-1-ylmethanol |
| PubChem CID | 20908 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | naphthalen-1-ylmethanol |
| SMILES | OCc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10O/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8H2 |
| InChIKey | PBLNHHSDYFYZNC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalen-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethanol?
The IUPAC name of naphthalen-1-ylmethanol (CID 20908) is naphthalen-1-ylmethanol.
What is the SMILES notation for naphthalen-1-ylmethanol?
The canonical SMILES for naphthalen-1-ylmethanol is OCc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylmethanol?
The InChIKey is PBLNHHSDYFYZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8H2.
What are the key properties of naphthalen-1-ylmethanol?
naphthalen-1-ylmethanol has a molecular weight of 158.20 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethanol is sourced from PubChem (CID 20908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).