C21H30FN3O4S — CID 20909285
N-cyclooctyl-1-(4-fluorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide (PubChem CID 20909285) has the molecular formula C21H30FN3O4S and a molecular weight of 439.55 g/mol. Its IUPAC name is N-cyclooctyl-1-(4-fluorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide.
| Compound Name | N-cyclooctyl-1-(4-fluorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 20909285 |
| Molecular Formula | C21H30FN3O4S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-cyclooctyl-1-(4-fluorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCCCC2)CN(S(C)(=O)=O)CC(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H30FN3O4S/c1-21(20(27)23-17-8-6-4-3-5-7-9-17)15-24(30(2,28)29)14-19(26)25(21)18-12-10-16(22)11-13-18/h10-13,17H,3-9,14-15H2,1-2H3,(H,23,27) |
| InChIKey | WZMXMAPFWMSRSB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |