C20H22ClN3O4S — CID 20909499
N-benzyl-1-(3-chlorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide (PubChem CID 20909499) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-benzyl-1-(3-chlorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide.
| Compound Name | N-benzyl-1-(3-chlorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 20909499 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-benzyl-1-(3-chlorophenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
| SMILES | CC1(C(=O)NCc2ccccc2)CN(S(C)(=O)=O)CC(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-20(19(26)22-12-15-7-4-3-5-8-15)14-23(29(2,27)28)13-18(25)24(20)17-10-6-9-16(21)11-17/h3-11H,12-14H2,1-2H3,(H,22,26) |
| InChIKey | BOFHTHBIBARNPR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |