C20H27N3O4S — CID 20910024
2-[methyl(6,7,8,9-tetrahydro-5H-carbazol-3-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 20910024) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[methyl(6,7,8,9-tetrahydro-5H-carbazol-3-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[methyl(6,7,8,9-tetrahydro-5H-carbazol-3-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 20910024 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[methyl(6,7,8,9-tetrahydro-5H-carbazol-3-ylsulfonyl)amino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CN(CC(=O)NCC1CCCO1)S(=O)(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C20H27N3O4S/c1-23(13-20(24)21-12-14-5-4-10-27-14)28(25,26)15-8-9-19-17(11-15)16-6-2-3-7-18(16)22-19/h8-9,11,14,22H,2-7,10,12-13H2,1H3,(H,21,24) |
| InChIKey | HIDKFNAMIHWDKL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|