C18H17BrN4O3S2 — CID 20910793
[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 20910793) has the molecular formula C18H17BrN4O3S2 and a molecular weight of 481.40 g/mol. Its IUPAC name is [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 20910793 |
| Molecular Formula | C18H17BrN4O3S2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)[nH]n1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H17BrN4O3S2/c19-13-3-5-14(6-4-13)28(25,26)23-9-7-22(8-10-23)18(24)16-12-15(20-21-16)17-2-1-11-27-17/h1-6,11-12H,7-10H2,(H,20,21) |
| InChIKey | QJMSXJJTZZIUAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |