C14H15BrN4O3 — CID 20910896
(5-bromofuran-2-yl)-[4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 20910896) has the molecular formula C14H15BrN4O3 and a molecular weight of 367.20 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 20910896 |
| Molecular Formula | C14H15BrN4O3 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)c3ccc(Br)o3)CC2)n[nH]1 |
| InChI | InChI=1S/C14H15BrN4O3/c1-9-8-10(17-16-9)13(20)18-4-6-19(7-5-18)14(21)11-2-3-12(15)22-11/h2-3,8H,4-7H2,1H3,(H,16,17) |
| InChIKey | JUAOEOSAZKSOSA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |